| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:48 UTC |
|---|
| Update Date | 2025-03-25 00:50:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178088 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O7 |
|---|
| Molecular Mass | 280.0583 |
|---|
| SMILES | COC(=O)c1ccccc1C(=O)OC(=O)CCC(=O)O |
|---|
| InChI Key | RPQQRUGMQLQZEL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acid estersbenzoyl derivativesbenzyloxycarbonylscarbonyl compoundscarboxylic acid anhydridescarboxylic acidshydrocarbon derivativesmethyl estersorganic oxides |
|---|
| Substituents | benzyloxycarbonylmonocyclic benzene moietycarbonyl groupcarboxylic acidbenzoylbenzoic acid or derivativestetracarboxylic acid or derivativesbenzoate esteraromatic homomonocyclic compoundorganic oxidemethyl esterorganic oxygen compoundcarboxylic acid estercarboxylic acid anhydridehydrocarbon derivativebenzenoidorganooxygen compound |
|---|
