| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:48 UTC |
|---|
| Update Date | 2025-03-25 00:50:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178101 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15NO3 |
|---|
| Molecular Mass | 221.1052 |
|---|
| SMILES | COC(=O)c1ccc(N2CCOCC2)cc1 |
|---|
| InChI Key | MMSNLLYQDUZFFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxazinanes |
|---|
| Subclass | morpholines |
|---|
| Direct Parent | phenylmorpholines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaminobenzoic acids and derivativesaniline and substituted anilinesazacyclic compoundsbenzoic acid estersbenzoyl derivativesdialkyl ethersdialkylarylamineshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyetheraromatic heteromonocyclic compoundamino acid or derivativesbenzoylbenzoate estercarboxylic acid derivativedialkyl etherorganic oxidemethyl estertertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary aminephenylmorpholineazacycleaniline or substituted anilinesbenzoic acid or derivativesoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
