Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:49:49 UTC |
---|
Update Date | 2025-03-25 00:50:00 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02178111 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C8H9NO5S |
---|
Molecular Mass | 231.0201 |
---|
SMILES | COC(=O)c1ccccc1NS(=O)(=O)O |
---|
InChI Key | NCBMFSAXWDBMEU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | benzoic acid esters |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | benzoyl derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssulfanilidessulfuric acid monoamidesvinylogous amides |
---|
Substituents | vinylogous amideorganic sulfuric acid or derivativesbenzoylbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundsulfanilideorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundsulfuric acid monoamideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|