| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:49 UTC |
|---|
| Update Date | 2025-03-25 00:50:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178117 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10N2O2S |
|---|
| Molecular Mass | 258.0463 |
|---|
| SMILES | Cn1cc(C=C2SC(=O)NC2=O)c2ccccc21 |
|---|
| InChI Key | XJCXGFYMMUZQET-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | n-alkylindoles |
|---|
| Direct Parent | n-alkylindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesdicarboximidesheteroaromatic compoundshydrocarbon derivativesindolesn-methylpyrrolesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssubstituted pyrrolesthiazolidinedionesthiazolidinesthiolactones |
|---|
| Substituents | carbonyl groupn-methylpyrrolen-alkylindoleindolesubstituted pyrrolecarboxylic acid derivativethiazolidinedioneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximidethiolactonecarbonic acid derivativeazacycleheteroaromatic compoundorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundthiazolidine |
|---|
