| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:50 UTC |
|---|
| Update Date | 2025-03-25 00:50:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178172 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14N2O5S |
|---|
| Molecular Mass | 310.0623 |
|---|
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1NCc1ccco1 |
|---|
| InChI Key | QAVFXOUHKZOQEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaminosulfonyl compoundsbenzenesulfonamidesbenzenesulfonyl compoundsbenzoyl derivativesfuransheteroaromatic compoundshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesoxacyclic compoundsphenylalkylaminessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | furanorganosulfonic acid or derivativesaromatic heteromonocyclic compoundamino acid or derivativesbenzoylbenzoate esterorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amideorganic oxidemethyl esterorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundbenzenesulfonyl groupvinylogous amidebenzenesulfonamideaminosulfonyl compoundheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineoxacyclemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativescarboxylic acid esterphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|