| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:50 UTC |
|---|
| Update Date | 2025-03-25 00:50:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178176 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10Cl2O3 |
|---|
| Molecular Mass | 296.0007 |
|---|
| SMILES | COC(=O)c1cc(Cl)ccc1Oc1ccc(Cl)cc1 |
|---|
| InChI Key | YSDKONNPVKULRF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 3-halobenzoic acids and derivativesaryl chloridesbenzoic acid estersbenzoyl derivativeschlorobenzenesdiarylethershydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etherether3-halobenzoic acid or derivativesorganochloridebenzoylbenzoate estercarboxylic acid derivativeorganohalogen compoundorganic oxidemethyl esteraryl chloridechlorobenzenebenzoic acid or derivativeshalobenzoic acid or derivativesaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|