| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:51 UTC |
|---|
| Update Date | 2025-03-25 00:50:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178222 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N3O7P |
|---|
| Molecular Mass | 333.0726 |
|---|
| SMILES | Cn1c(=N)ccn(C2C(O)C(O)C3COP(=O)(O)OC32)c1=O |
|---|
| InChI Key | OCEDLGALFZPTOU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscyclic alcohols and derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholsureas |
|---|
| Substituents | alcoholcarbonic acid derivativeazacycleheteroaromatic compoundpyrimidonecyclic alcoholpyrimidineureaoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundimidolactamorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compound1,2-diolcyclopentyl nucleoside |
|---|