| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:53 UTC |
|---|
| Update Date | 2025-03-25 00:50:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178289 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H4F10O3 |
|---|
| Molecular Mass | 326.0001 |
|---|
| SMILES | COC(=O)C(O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
| InChI Key | AZHXOHPYFFHRLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | fatty acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl fluoridesalpha-halocarboxylic acid derivativescarbonyl compoundsfluorohydrinshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganofluorides |
|---|
| Substituents | alcoholalpha-halocarboxylic acid or derivativesaliphatic acyclic compoundcarbonyl grouphalohydrinalkyl fluorideorganofluoridefluorohydrincarboxylic acid derivativeorganohalogen compoundalpha-halocarboxylic acid derivativefatty acid esterorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundcarboxylic acid esteralkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
