| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:54 UTC |
|---|
| Update Date | 2025-03-25 00:50:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178332 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H13N3O2S |
|---|
| Molecular Mass | 263.0728 |
|---|
| SMILES | Cn1c(Cc2ccccc2)nnc1SCC(=O)O |
|---|
| InChI Key | JBADIAAIHVTSEM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organosulfur compounds |
|---|
| Class | thioethers |
|---|
| Subclass | aryl thioethers |
|---|
| Direct Parent | aryl thioethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compoundstriazoles |
|---|
| Substituents | triazolemonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundalkylarylthioethercarboxylic acid derivativearyl thioetherorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolesulfenyl compound1,2,4-triazoleazacycleheteroaromatic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|