| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:56 UTC |
|---|
| Update Date | 2025-03-25 00:50:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178417 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H15NO8S |
|---|
| Molecular Mass | 273.0518 |
|---|
| SMILES | COC1C(O)C(O)C(NS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | QPDVHZWFDNDDPM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | sulfamic acid derivatives |
|---|
| Subclass | cyclamates |
|---|
| Direct Parent | cyclamates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfuric acid monoamides |
|---|
| Substituents | alcoholetherorganic sulfuric acid or derivativescyclohexanolcyclamic_acid_derivativecyclitol or derivativescyclic alcoholdialkyl etherorganic oxideorganic oxygen compoundorganonitrogen compoundsulfuric acid monoamidesecondary alcoholaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
