| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:57 UTC |
|---|
| Update Date | 2025-03-25 00:50:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178424 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21NO7 |
|---|
| Molecular Mass | 327.1318 |
|---|
| SMILES | COC1C(O)C(O)C(Oc2ccc(NC(C)=O)cc2)C(O)C1O |
|---|
| InChI Key | HMLNPLHXKNKOFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl etherscarbonyl compoundscarboxylic acids and derivativescyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupethern-acetylarylaminen-arylamidealkyl aryl ethercarboxylic acid derivativedialkyl etherorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidealcoholacetanilidecyclohexanolcyclitol or derivativescyclic alcoholcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
