| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:59 UTC |
|---|
| Update Date | 2025-03-25 00:50:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178502 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11N5 |
|---|
| Molecular Mass | 237.1014 |
|---|
| SMILES | Cc1ccccc1-c1cnc2ncnc(N)c2n1 |
|---|
| InChI Key | SVUGZIQCJMQNSO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrazinespyrimidines and pyrimidine derivativestoluenes |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compoundpteridinepyrimidinearomatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamtolueneamine |
|---|
