| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:59 UTC |
|---|
| Update Date | 2025-03-25 00:50:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178520 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N3O4 |
|---|
| Molecular Mass | 265.1063 |
|---|
| SMILES | COC1C(O)C(CO)OC1n1ccc2cncnc21 |
|---|
| InChI Key | OJVNOYBLVYHSOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrrolopyrimidine nucleosides and nucleotides |
|---|
| Subclass | pyrrolopyrimidine nucleosides and nucleotides |
|---|
| Direct Parent | pyrrolopyrimidine nucleosides and nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidines and pyrimidine derivativespyrrolo[2,3-d]pyrimidinessecondary alcoholssubstituted pyrrolestetrahydrofurans |
|---|
| Substituents | ethermonosaccharidesubstituted pyrroledialkyl etherpyrimidinepyrrolopyrimidinesaccharidepyrrolo[2,3-d]pyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundalcoholazacycletetrahydrofuranheteroaromatic compoundpyrrolopyrimidine ribonucleosideoxacycleorganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
