Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:50:00 UTC |
---|
Update Date | 2025-03-25 00:50:04 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02178548 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H15NO5S |
---|
Molecular Mass | 321.0671 |
---|
SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
---|
InChI Key | ZLKDQJGTQQUFHP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | sulfanilides |
---|
Direct Parent | sulfanilides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsaminosulfonyl compoundsbenzenesulfonamidesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidessalicylic acidsvinylogous acidsm-xylenes |
---|
Substituents | organosulfonic acid or derivativescarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amidexyleneorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidbenzenesulfonyl groupbenzenesulfonamideaminosulfonyl compoundm-xylenebenzoic acid or derivativeshydroxybenzoic acidaromatic homomonocyclic compoundsulfanilidevinylogous acidmonocarboxylic acid or derivativessulfonylorganic oxygen compoundsalicylic acid or derivativesorganic sulfonic acid or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|