| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:03 UTC |
|---|
| Update Date | 2025-03-25 00:50:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178659 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N5O |
|---|
| Molecular Mass | 207.112 |
|---|
| SMILES | CNc1nc(=O)c2ncn(C(C)C)c2[nH]1 |
|---|
| InChI Key | LUMZHXDLDQYBES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganooxygen compoundsorganopnictogen compoundspurines and purine derivativespyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | vinylogous amideazacycleheteroaromatic compoundpyrimidonesecondary aminesecondary aliphatic/aromatic aminepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamineazolen-substituted imidazole |
|---|
