| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:05 UTC |
|---|
| Update Date | 2025-03-25 00:50:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178734 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11NO2 |
|---|
| Molecular Mass | 213.079 |
|---|
| SMILES | OCc1c[nH]c2ccc3cc(O)ccc3c12 |
|---|
| InChI Key | XSBDJMZIYGJMFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindole-3-carbinol and derivativesindolesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | aromatic alcoholalcoholazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidindole or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeindole-3-carbinol or derivativesorganic nitrogen compound2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|
