| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:06 UTC |
|---|
| Update Date | 2025-03-25 00:50:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178745 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H19NO7 |
|---|
| Molecular Mass | 325.1162 |
|---|
| SMILES | OCc1c[nH]c2cc(OC3OC(CO)C(O)C(O)C3O)ccc12 |
|---|
| InChI Key | MCYADDMEECPRCY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indole-3-carbinol and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsaromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesmonosaccharidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersprimary alcoholspyrrolessecondary alcohols |
|---|
| Substituents | aromatic alcoholphenol ethermonosaccharidesaccharideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholalcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativebenzenoidindole-3-carbinol or derivativesorganic nitrogen compoundorganooxygen compound |
|---|
