Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:50:09 UTC |
---|
Update Date | 2025-03-25 00:50:07 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02178850 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C24H38N6O5S2 |
---|
Molecular Mass | 554.2345 |
---|
SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(CCSC)NC(=O)C(N)CCC(N)=O)C(N)=O |
---|
InChI Key | VJUXMKIONUKMEU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic polymers |
---|
Class | polypeptides |
---|
Subclass | polypeptides |
---|
Direct Parent | polypeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdialkylthioethersglutamine and derivativeshydrocarbon derivativesmethionine and derivativesmonoalkylaminesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspeptidesphenylalanine and derivativesprimary carboxylic acid amidessecondary carboxylic acid amidessulfenyl compounds |
---|
Substituents | primary carboxylic acid amidefatty acylmonocyclic benzene moietycarbonyl groupglutamine or derivativesfatty amidealpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativealpha peptideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativespolypeptidesulfenyl compoundalpha-amino acid amiden-acyl-alpha-amino aciddialkylthioethercarboxamide groupn-acyl-aminen-substituted-alpha-amino acidaromatic homomonocyclic compoundsecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundthioethermethionine or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|