| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:10 UTC |
|---|
| Update Date | 2025-03-25 00:50:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178894 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H18O5 |
|---|
| Molecular Mass | 350.1154 |
|---|
| SMILES | Oc1ccc(C2OCc3cc(O)ccc3C2c2ccc(O)c(O)c2)cc1 |
|---|
| InChI Key | QMGPIAVCHJRYTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-benzopyransbenzene and substituted derivativesdialkyl ethershydrocarbon derivativesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietybenzopyranether1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compound2-benzopyranisochromanephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compoundstilbene |
|---|
