Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:50:12 UTC |
---|
Update Date | 2025-03-25 00:50:08 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02178963 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H21N3O6 |
---|
Molecular Mass | 339.143 |
---|
SMILES | COc1ccc(CC(NC(=O)C(N)CCC(N)=O)C(=O)O)cc1O |
---|
InChI Key | OVMAONKIBCLMGX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersalpha amino acid amidesalpha amino acidsanisolescarbonyl compoundscarboxylic acidsglutamine and derivativeshydrocarbon derivativesmethoxybenzenesmethoxylated amphetaminesmethoxyphenolsmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenylalanine and derivativesphenylpropanoic acidsprimary carboxylic acid amidessecondary carboxylic acid amides |
---|
Substituents | primary carboxylic acid amidefatty acylphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidglutamine or derivatives3-phenylpropanoic-acidfatty amide1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalpha-amino acid or derivativesalkyl aryl etherorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesalpha-amino acid amiden-acyl-alpha-amino acidmethoxylated amphetamine1-hydroxy-4-unsubstituted benzenoidcarboxamide groupmethoxybenzenen-acyl-aminearomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compoundorganooxygen compound |
---|