| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:13 UTC |
|---|
| Update Date | 2025-03-25 00:50:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179015 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O4 |
|---|
| Molecular Mass | 310.1205 |
|---|
| SMILES | COc1ccc(C=CC(=O)OC(C)C(=O)c2ccccc2)cc1 |
|---|
| InChI Key | KHOXLLAKJLESAA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha-acyloxy ketonesanisolesaryl alkyl ketonesbenzoyl derivativescinnamic acids and derivativesenoate estersfatty acid estershydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylpropanes |
|---|
| Substituents | fatty acylphenol ethermonocyclic benzene moietyetheraryl alkyl ketonealpha-acyloxy ketonebenzoylalkyl aryl ethercarboxylic acid derivativephenylpropanealpha,beta-unsaturated carboxylic estercinnamic acid or derivativesorganic oxideenoate estermethoxybenzenearomatic homomonocyclic compoundfatty acid estermonocarboxylic acid or derivativesanisolecarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketone |
|---|