| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:16 UTC |
|---|
| Update Date | 2025-03-25 00:50:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179109 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H22N2S |
|---|
| Molecular Mass | 286.1504 |
|---|
| SMILES | CSc1ccc(C(CCN(C)C)c2ccccn2)cc1 |
|---|
| InChI Key | NVFJZEWZDWTIEL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pheniramines |
|---|
| Direct Parent | pheniramines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkylarylthioethersazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesmethylpyridinesorganopnictogen compoundssulfenyl compoundsthiophenol ethersthiophenolstrialkylamines |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundpheniraminealkylarylthioetherorganosulfur compoundaryl thioetherthiophenolthiophenol etherorganonitrogen compoundorganopnictogen compound2-halopyridinetertiary aminesulfenyl compoundazacycleheteroaromatic compoundtertiary aliphatic aminemethylpyridinethioetherhydrocarbon derivativebenzenoidorganic nitrogen compoundamine |
|---|
