| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:16 UTC |
|---|
| Update Date | 2025-03-25 00:50:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179119 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O6S2 |
|---|
| Molecular Mass | 263.9762 |
|---|
| SMILES | CSc1cc(C(=O)O)ccc1OS(=O)(=O)O |
|---|
| InChI Key | LYPAYQQKUVMBPG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesm-sulfanylbenzoic acidsmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenoxy compoundssulfenyl compoundssulfuric acid monoestersthiophenol ethersthiophenols |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoestercarboxylic acidbenzoylalkylarylthioetherorganosulfur compoundcarboxylic acid derivativearyl thioetherphenylsulfateorganic oxidethiophenolthiophenol etherbenzoic acidm-sulfanylbenzoic acidsulfenyl compoundbenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundthioethersulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterm-sulfanylbenzoic acid or derivativesorganooxygen compound |
|---|