| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:18 UTC |
|---|
| Update Date | 2025-03-25 00:50:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179190 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16NO7+ |
|---|
| Molecular Mass | 250.0921 |
|---|
| SMILES | C[N+](C)(C)C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
|---|
| InChI Key | HKNDHOQZFYZBHD-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaminescarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstertiary alcoholstetraalkylammonium saltstricarboxylic acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidtetraalkylammonium saltquaternary ammonium saltalpha-hydroxy acidtricarboxylic acid or derivativeshydroxy acidtertiary alcoholorganic oxideorganic oxygen compoundalpha-amino acidorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|