| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:19 UTC |
|---|
| Update Date | 2025-03-25 00:50:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179234 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H10Cl2O3 |
|---|
| Molecular Mass | 320.0007 |
|---|
| SMILES | Oc1ccc2cc(O)c(Oc3ccc(Cl)cc3Cl)cc2c1 |
|---|
| InChI Key | KHBFXZUSHOZYQM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl chloridesdiarylethersdichlorobenzeneshydrocarbon derivativesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | aryl chloridechlorobenzenediaryl etherphenol ethermonocyclic benzene moietyetherorganochloride1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundorganohalogen compoundaryl halide1,3-dichlorobenzeneorganic oxygen compoundhydrocarbon derivativehalobenzenephenoxy compound2-naphtholorganooxygen compound |
|---|
