| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:22 UTC |
|---|
| Update Date | 2025-03-25 00:50:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179329 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N4O2S |
|---|
| Molecular Mass | 330.115 |
|---|
| SMILES | CSCCCn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21 |
|---|
| InChI Key | SBSFUPIDQNHIPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | alloxazines and isoalloxazines |
|---|
| Direct Parent | flavins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsdialkylthioethersdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrazinespyrimidonesquinoxalinessulfenyl compounds |
|---|
| Substituents | lactampyrimidoneorganosulfur compoundflavinpyrimidineorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundquinoxalinecarbonic acid derivativesulfenyl compoundazacycledialkylthioetherheteroaromatic compoundorganic oxygen compoundthioetherpyrazinehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
