| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:22 UTC |
|---|
| Update Date | 2025-03-25 00:50:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179340 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21N5O4S |
|---|
| Molecular Mass | 355.1314 |
|---|
| SMILES | CSCCNc1nc(N)nc2c1ccn2C1OC(CO)C(O)C1O |
|---|
| InChI Key | ZEYGSPFVHNYKFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrrolopyrimidine nucleosides and nucleotides |
|---|
| Subclass | pyrrolopyrimidine nucleosides and nucleotides |
|---|
| Direct Parent | pyrrolopyrimidine nucleosides and nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidines and pyrimidine derivativespyrrolo[2,3-d]pyrimidinessecondary alcoholssecondary alkylarylaminessubstituted pyrrolessulfenyl compoundstetrahydrofurans |
|---|
| Substituents | monosaccharidesubstituted pyrroleorganosulfur compoundpyrimidinepyrrolopyrimidinesaccharidepyrrolo[2,3-d]pyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundalcoholsulfenyl compoundazacycletetrahydrofurandialkylthioetherheteroaromatic compoundsecondary aminepyrrolopyrimidine ribonucleosidesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundthioetherpyrrolesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
