| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:23 UTC |
|---|
| Update Date | 2025-03-25 00:50:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179389 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H21Cl2N3O4 |
|---|
| Molecular Mass | 485.0909 |
|---|
| SMILES | COc1ccc2nccc(OCC3COC(Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)c2c1 |
|---|
| InChI Key | QTZVWKVEVXMYOR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | haloquinolines |
|---|
| Direct Parent | chloroquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanes2-halopyridinesalkyl aryl ethersanisolesaryl chloridesazacyclic compoundsdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesimidazolesketalsmethylpyridinesn-substituted imidazolesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinesquinolines and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietymeta-dioxolaneetherpolyhalopyridineorganochloridealkyl aryl etherorganohalogen compound1,3-dichlorobenzeneacetalaromatic heteropolycyclic compoundimidazoleketalorganonitrogen compoundorganopnictogen compound2-halopyridineazolen-substituted imidazolearyl chloridechlorobenzeneazacycleheteroaromatic compoundmethylpyridinearyl halideoxacyclepyridineorganic oxygen compoundchloroquinolineanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
