| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:23 UTC |
|---|
| Update Date | 2025-03-25 00:50:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179393 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O6 |
|---|
| Molecular Mass | 300.0634 |
|---|
| SMILES | COc1ccc2oc(=O)c(-c3ccc(O)c(O)c3)c(O)c2c1 |
|---|
| InChI Key | IAKVZBXHBIERCE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-3-enes |
|---|
| Direct Parent | isoflav-3-enones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4-hydroxycoumarinsalkyl aryl ethersanisolesbenzene and substituted derivativescoumarins and derivativesheteroaromatic compoundshydrocarbon derivativesisoflavonoidslactonesorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherisoflav-3-enone skeletonlactoneorganic oxidearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound4-hydroxycoumarinbenzopyranheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidcoumarinoxacyclevinylogous acidorganic oxygen compoundpyrananisolephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|