| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:23 UTC |
|---|
| Update Date | 2025-03-25 00:50:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179398 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18O4 |
|---|
| Molecular Mass | 298.1205 |
|---|
| SMILES | COc1cccc(C(=O)C=Cc2ccc(OC)c(OC)c2)c1 |
|---|
| InChI Key | LABXLRQBRJUXNG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | linear 1,3-diarylpropanoids |
|---|
| Direct Parent | linear 1,3-diarylpropanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha,beta-unsaturated ketonesanisolesaryl ketonesbenzoyl derivativescinnamic acids and derivativesdimethoxybenzeneshydrocarbon derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | linear 1,3-diarylpropanoidphenol ethermonocyclic benzene moietyetherbenzoylalkyl aryl etheralpha,beta-unsaturated ketonemethoxybenzeneketonearomatic homomonocyclic compounddimethoxybenzenecinnamic acid or derivativesorganic oxideorganic oxygen compoundanisoleo-dimethoxybenzenehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketone |
|---|
