| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:25 UTC |
|---|
| Update Date | 2025-03-25 00:50:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179465 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13N5O |
|---|
| Molecular Mass | 255.112 |
|---|
| SMILES | COc1cccc(CNc2ncnc3nc[nH]c23)c1 |
|---|
| InChI Key | JLFVTVWYTKYYPS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmethoxybenzenesorganopnictogen compoundsphenoxy compoundspyrimidines and pyrimidine derivativessecondary alkylarylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheralkyl aryl etherpyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamazoleazacycleheteroaromatic compoundsecondary aminemethoxybenzenesecondary aliphatic/aromatic amineorganic oxygen compoundanisolehydrocarbon derivativebenzenoidpurineorganic nitrogen compoundphenoxy compoundorganooxygen compoundamine |
|---|