| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:26 UTC |
|---|
| Update Date | 2025-03-25 00:50:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179513 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24ClNO |
|---|
| Molecular Mass | 305.1546 |
|---|
| SMILES | COc1ccc2c(c1Cl)C13CCCCC1C(C2)N(C)CC3 |
|---|
| InChI Key | QOKKUAJIDIRNOA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaryl chloridesazacyclic compoundsbenzazocineshydrocarbon derivativesorganochloridesorganopnictogen compoundsphenanthrenes and derivativespiperidinestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretherorganochloridealkyl aryl etherorganohalogen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundaryl chloridephenanthreneazacycletertiary aliphatic aminearyl halideorganic oxygen compoundanisolebenzazocinehydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
