| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:29 UTC |
|---|
| Update Date | 2025-03-25 00:50:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179599 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19N3O3 |
|---|
| Molecular Mass | 277.1426 |
|---|
| SMILES | COc1ccc(NC(=O)N2CCN(C(C)=O)CC2)cc1 |
|---|
| InChI Key | SXCMJXHXXQRLRQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | n-phenylureas |
|---|
| Direct Parent | n-phenylureas |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspiperazine carboxamidespiperazinestertiary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupetheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativepiperazine-1-carboxamideorganic oxidepiperazinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamidecarbonic acid derivativeazacyclecarboxamide groupmethoxybenzenen-phenylureaorganic oxygen compoundanisole1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
