| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:29 UTC |
|---|
| Update Date | 2025-03-25 00:50:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179606 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18N2O4 |
|---|
| Molecular Mass | 314.1267 |
|---|
| SMILES | COc1ccc(NC=O)c(C(=O)C(N)Cc2ccc(O)cc2)c1 |
|---|
| InChI Key | OQSKPGPPPLJPAU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | retro-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersalkyl-phenylketonesamphetamines and derivativesanilidesanisolesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acids and derivativescinnamylphenolshydrocarbon derivativesmethoxybenzenesmonoalkylaminesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidn-arylamidecinnamylphenolretro-dihydrochalconealkyl aryl ethercarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundorganopnictogen compoundamphetamine or derivativesvinylogous amidecarboxamide groupmethoxybenzenephenylketonebutyrophenonearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
