| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:29 UTC |
|---|
| Update Date | 2025-03-25 00:50:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179613 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO3S |
|---|
| Molecular Mass | 225.046 |
|---|
| SMILES | CS(=O)C(=O)NC(=O)Cc1ccccc1 |
|---|
| InChI Key | KXULTEXRCXDSCK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfinyl compoundssulfoxidesthiolactones |
|---|
| Substituents | carbonyl groupcarbonic acid derivativeorganosulfur compoundcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundsulfinyl compoundorganonitrogen compoundsulfoxideorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compoundthiolactonephenylacetamideorganooxygen compound |
|---|
