| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:33 UTC |
|---|
| Update Date | 2025-03-25 00:50:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179738 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15NO3 |
|---|
| Molecular Mass | 233.1052 |
|---|
| SMILES | COc1ccc2c(=O)oc(CN(C)C)cc2c1 |
|---|
| InChI Key | NPYPTFQJYBQGCJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isocoumarins and derivatives |
|---|
| Subclass | isocoumarins and derivatives |
|---|
| Direct Parent | isocoumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-benzopyransalkyl aryl ethersanisolesaralkylaminesheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganopnictogen compoundsoxacyclic compoundspyranones and derivativestrialkylamines |
|---|
| Substituents | phenol etheretheralkyl aryl etheraralkylaminelactoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyranoneorganopnictogen compoundtertiary amineorganoheterocyclic compoundbenzopyranheteroaromatic compoundtertiary aliphatic amineisocoumarinoxacycleorganic oxygen compoundpyrananisole2-benzopyranhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
