| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:33 UTC |
|---|
| Update Date | 2025-03-25 00:50:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179746 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14N2O2 |
|---|
| Molecular Mass | 242.1055 |
|---|
| SMILES | COc1ccccc1NC(=O)c1cnccc1C |
|---|
| InChI Key | WPEGQVADJZLDQP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethylpyridinesnicotinamidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspolyhalopyridinespyridinecarboxylic acids and derivativessecondary carboxylic acid amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesphenol etheretheraromatic heteromonocyclic compoundpolyhalopyridinenicotinamidealkyl aryl ethercarboxylic acid derivativearomatic anilideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazacycleheteroaromatic compoundmethylpyridinecarboxamide groupmethoxybenzenesecondary carboxylic acid amidepyridineorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
