| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:33 UTC |
|---|
| Update Date | 2025-03-25 00:50:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179759 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18O3S |
|---|
| Molecular Mass | 230.0977 |
|---|
| SMILES | CS(=O)(=O)OC12CC3CC(CC(C3)C1)C2 |
|---|
| InChI Key | DHINVMZVWZGDAB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | sulfonic acid esters |
|---|
| Direct Parent | sulfonic acid esters |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmethanesulfonatesorganic oxidesorganooxygen compoundsorganosulfonic acid esterssulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesorganosulfur compoundorganosulfonic acid esteraliphatic homopolycyclic compoundsulfonic acid estermethanesulfonateorganic oxidesulfonylorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|