Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:50:33 UTC |
---|
Update Date | 2025-03-25 00:50:15 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02179761 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C7H13NO8S |
---|
Molecular Mass | 271.0362 |
---|
SMILES | CS(=O)(=O)NC1OC(C(=O)O)C(O)C(O)C1O |
---|
InChI Key | KHJZLKUGZMDJCD-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | glucuronic acid derivatives |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | aminosulfonyl compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic sulfonamidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
---|
Substituents | organosulfonic acid or derivativescarbonyl groupcarboxylic acidglucuronic acid or derivativesmonosaccharideorganosulfur compoundcarboxylic acid derivativepyran carboxylic acidorganosulfonic acid amidebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesaminosulfonyl compoundhydroxy acidoxacyclemonocarboxylic acid or derivativessulfonylorganic sulfonic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amide |
---|