| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:33 UTC |
|---|
| Update Date | 2025-03-25 00:50:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179765 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15NO6S |
|---|
| Molecular Mass | 301.062 |
|---|
| SMILES | CS(=O)(=O)Nc1c(O)cc(CC2CCC(=O)O2)cc1O |
|---|
| InChI Key | NOMBYUVOWWLURZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | sulfanilides |
|---|
| Direct Parent | sulfanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaminosulfonyl compoundscarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic sulfonamidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidesoxacyclic compoundsresorcinolstetrahydrofurans |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativeresorcinolorganosulfonic acid amidelactoneorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundaminosulfonyl compoundtetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactonesulfanilideoxacyclemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativescarboxylic acid esterphenolhydrocarbon derivativeorganic nitrogen compoundorganic sulfonic acid amideorganooxygen compound |
|---|