| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:33 UTC |
|---|
| Update Date | 2025-03-25 00:50:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02179770 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11N5O3S |
|---|
| Molecular Mass | 317.0583 |
|---|
| SMILES | CS(=O)(=O)c1ccc(-c2cnc3nc(N)[nH]c(=O)c3n2)cc1 |
|---|
| InChI Key | ZNSVKZFDCOEIJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenesulfonyl compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidonessulfones |
|---|
| Substituents | monocyclic benzene moietylactampyrimidoneorganosulfur compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl grouppterinazacycleheteroaromatic compoundsulfonylorganic oxygen compoundpyrazinehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compoundsulfone |
|---|