| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:42 UTC |
|---|
| Update Date | 2025-03-25 00:50:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180104 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H30O16 |
|---|
| Molecular Mass | 562.1534 |
|---|
| SMILES | COc1cc(C=CC(=O)OC2C(O)CC(O)(OC3OC(C(=O)O)C(O)C(O)C3O)C(O)C2O)cc(OC)c1O |
|---|
| InChI Key | VEMOVSQRPWMPHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclohexanolsdicarboxylic acids and derivativesdimethoxybenzenesenoate estersfatty acid estersglucuronic acid derivativeshemiacetalshydrocarbon derivativeshydroxycinnamic acidsmethoxyphenolsmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acido-glucuronidemethoxyphenolmonosaccharidepyran carboxylic acid1-o-glucuronidealpha,beta-unsaturated carboxylic esterbeta-hydroxy acidacetalhemiacetaloxaneorganoheterocyclic compoundenoate esteralcoholcyclohexanolcyclitol or derivativesmethoxybenzenefatty acid esterm-dimethoxybenzeneanisolecarboxylic acid esterdicarboxylic acid or derivativesphenolhydrocarbon derivativephenoxy compoundfatty acylcarbonyl groupetheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativehydroxycinnamic acid or derivativesdimethoxybenzenecinnamic acid or derivativesorganic oxidepyran carboxylic acid or derivativeshydroxy acidcyclic alcoholhydroxycinnamic acidoxacyclepyransecondary alcoholbenzenoid |
|---|