| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:43 UTC |
|---|
| Update Date | 2025-03-25 00:50:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180124 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O6 |
|---|
| Molecular Mass | 368.126 |
|---|
| SMILES | COc1cc(C=CC(=O)C(=O)C=Cc2ccc(OC)c(OC)c2)ccc1O |
|---|
| InChI Key | YVDOLFNJOOVBSK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacryloyl compoundsalkyl aryl ethersalpha-diketonesanisolesdimethoxybenzenesenoneshydrocarbon derivativesmethoxyphenolsorganic oxidesphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etheralpha,beta-unsaturated ketoneketonedimethoxybenzeneorganic oxideo-dimethoxybenzeneenonemethoxybenzenealpha-diketonehydroxycinnamic acidaromatic homomonocyclic compoundorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundorganooxygen compound |
|---|
