| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:48 UTC |
|---|
| Update Date | 2025-03-25 00:50:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180330 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H16O8S |
|---|
| Molecular Mass | 440.0566 |
|---|
| SMILES | COc1ccc(-c2c(-c3ccc(O)cc3)oc3cc(OS(=O)(=O)O)ccc3c2=O)cc1 |
|---|
| InChI Key | LFNHHDBNKYCIGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 4'-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesarylsulfateschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesisoflavonesisoflavonoidsmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativessulfuric acid monoesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoesterether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundisoflavonoidpyranonearylsulfateorganoheterocyclic compoundisoflavonebenzopyranorganic sulfuric acid or derivativesheteroaromatic compoundisoflavonoid skeletonmethoxybenzeneoxacycleorganic oxygen compoundpyrananisole4'-hydroxyflavonoidsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|