| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:48 UTC |
|---|
| Update Date | 2025-03-25 00:50:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180333 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H14O5 |
|---|
| Molecular Mass | 334.0841 |
|---|
| SMILES | Oc1ccc(-c2oc3cccc(O)c3c2-c2ccc(O)c(O)c2)cc1 |
|---|
| InChI Key | UOLTZHXAVQWDIB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | 2-arylbenzofuran flavonoids |
|---|
| Subclass | 2-arylbenzofuran flavonoids |
|---|
| Direct Parent | 2-arylbenzofuran flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesfuransheteroaromatic compoundshydrocarbon derivativesorganooxygen compoundsoxacyclic compoundsphenylbenzofurans |
|---|
| Substituents | furanmonocyclic benzene moietybenzofuran2-arylbenzofuran flavonoidheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphenylbenzofuranoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
