| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:50 UTC |
|---|
| Update Date | 2025-03-25 00:50:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180414 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H20NO+ |
|---|
| Molecular Mass | 254.1539 |
|---|
| SMILES | C[N+]1(C)CC(c2ccc(O)cc2)Cc2ccccc21 |
|---|
| InChI Key | JZZWVVPHAHRHEJ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | phenylquinolines |
|---|
| Direct Parent | phenylquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaminesazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativeshydroquinolinesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compoundsquaternary ammonium salts |
|---|
| Substituents | monocyclic benzene moietyazacyclephenylquinolinequaternary ammonium salt1-hydroxy-2-unsubstituted benzenoidorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic cationorganic salttetrahydroquinolineamineorganooxygen compound |
|---|
