| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:51 UTC |
|---|
| Update Date | 2025-03-25 00:50:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180481 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H22NO6+ |
|---|
| Molecular Mass | 264.1442 |
|---|
| SMILES | C[N+](C)(C)C1C(O)C(O)C(O)CC1(O)CC(=O)O |
|---|
| InChI Key | IVTOQJHPMVDBHM-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | aminocyclitols and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaminescarbonyl compoundscarboxylic acidscyclohexanolscyclohexylamineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstertiary alcoholstetraalkylammonium salts |
|---|
| Substituents | carbonyl groupcarboxylic acidcyclohexylaminecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltaminocyclitol or derivativestetraalkylammonium salt1,2-aminoalcoholquaternary ammonium saltcyclohexanoltertiary alcoholmonocarboxylic acid or derivativessecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganic nitrogen compoundamine |
|---|