| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:52 UTC |
|---|
| Update Date | 2025-03-25 00:50:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180483 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20O6 |
|---|
| Molecular Mass | 356.126 |
|---|
| SMILES | Oc1ccc(C2C(O)C3CC2C3C(O)c2ccc3c(c2)OCO3)cc1O |
|---|
| InChI Key | ZXEPIJAQIRKDBD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzodioxoles |
|---|
| Subclass | benzodioxoles |
|---|
| Direct Parent | benzodioxoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsaromatic alcoholsbenzene and substituted derivativescyclic alcohols and derivativeshydrocarbon derivativesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcyclic alcoholoxacycleorganic oxygen compoundacetalaromatic heteropolycyclic compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compoundbenzodioxole |
|---|
