| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:52 UTC |
|---|
| Update Date | 2025-03-25 00:50:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180488 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H28NO11+ |
|---|
| Molecular Mass | 398.1657 |
|---|
| SMILES | C[N+](C)(C)C1C(OC2OC(C(=O)O)C(O)C(O)C2O)OC(CO)C(O)C1O |
|---|
| InChI Key | ITIUIBBVMMUIOZ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | aminoglycosides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsacetalsaminesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | carbonyl groupcarboxylic acidglucuronic acid or derivativeso-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundaminoglycoside coreorganopnictogen compoundorganic cationoxaneorganic saltprimary alcoholorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativestetraalkylammonium salt1,2-aminoalcoholquaternary ammonium salthydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamine |
|---|