| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:50:52 UTC |
|---|
| Update Date | 2025-03-25 00:50:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02180493 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H16O4 |
|---|
| Molecular Mass | 308.1049 |
|---|
| SMILES | COc1ccc(C2=C(CCC(=O)O)c3ccccc3C2=O)cc1 |
|---|
| InChI Key | RIEHPAFSIRPEOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indenes and isoindenes |
|---|
| Subclass | indenes and isoindenes |
|---|
| Direct Parent | indenes and isoindenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaryl ketonescarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic homopolycyclic compoundalkyl aryl ethercarboxylic acid derivativemethoxybenzeneketoneorganic oxidemonocarboxylic acid or derivativesindeneorganic oxygen compoundanisolehydrocarbon derivativephenoxy compoundorganooxygen compoundaryl ketone |
|---|
